C26H52N2O4 — CID 170040572
2-methyl-N-[5-[5-[(2-octoxyacetyl)amino]pentoxy]pentyl]pentanamide (PubChem CID 170040572) has the molecular formula C26H52N2O4 and a molecular weight of 456.71 g/mol. Its IUPAC name is 2-methyl-N-[5-[5-[(2-octoxyacetyl)amino]pentoxy]pentyl]pentanamide.
| Compound Name | 2-methyl-N-[5-[5-[(2-octoxyacetyl)amino]pentoxy]pentyl]pentanamide |
|---|---|
| PubChem CID | 170040572 |
| Molecular Formula | C26H52N2O4 |
| Molecular Weight | 456.71 g/mol |
| Exact Mass | 456.39 |
| IUPAC Name | 2-methyl-N-[5-[5-[(2-octoxyacetyl)amino]pentoxy]pentyl]pentanamide |
| SMILES | CCCCCCCCOCC(=O)NCCCCCOCCCCCNC(=O)C(C)CCC |
| InChI | InChI=1S/C26H52N2O4/c1-4-6-7-8-9-14-22-32-23-25(29)27-18-12-10-15-20-31-21-16-11-13-19-28-26(30)24(3)17-5-2/h24H,4-23H2,1-3H3,(H,27,29)(H,28,30) |
| InChIKey | NZVBBMPXZBHZPX-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.71 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|