C14H29NO3 — CID 156795089
N-butyl-2-[2-(4-methylpentoxy)ethoxy]acetamide (PubChem CID 156795089) has the molecular formula C14H29NO3 and a molecular weight of 259.39 g/mol. Its IUPAC name is N-butyl-2-[2-(4-methylpentoxy)ethoxy]acetamide.
| Compound Name | N-butyl-2-[2-(4-methylpentoxy)ethoxy]acetamide |
|---|---|
| PubChem CID | 156795089 |
| Molecular Formula | C14H29NO3 |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.21 |
| IUPAC Name | N-butyl-2-[2-(4-methylpentoxy)ethoxy]acetamide |
| SMILES | CCCCNC(=O)COCCOCCCC(C)C |
| InChI | InChI=1S/C14H29NO3/c1-4-5-8-15-14(16)12-18-11-10-17-9-6-7-13(2)3/h13H,4-12H2,1-3H3,(H,15,16) |
| InChIKey | RSUPGYKNDXMCSU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|