C21H43NO4 — CID 130253038
6-methyl-N-[3-[2-[2-(4-methylpentoxy)ethoxy]ethoxy]propyl]heptanamide (PubChem CID 130253038) has the molecular formula C21H43NO4 and a molecular weight of 373.58 g/mol. Its IUPAC name is 6-methyl-N-[3-[2-[2-(4-methylpentoxy)ethoxy]ethoxy]propyl]heptanamide.
| Compound Name | 6-methyl-N-[3-[2-[2-(4-methylpentoxy)ethoxy]ethoxy]propyl]heptanamide |
|---|---|
| PubChem CID | 130253038 |
| Molecular Formula | C21H43NO4 |
| Molecular Weight | 373.58 g/mol |
| Exact Mass | 373.32 |
| IUPAC Name | 6-methyl-N-[3-[2-[2-(4-methylpentoxy)ethoxy]ethoxy]propyl]heptanamide |
| SMILES | CC(C)CCCCC(=O)NCCCOCCOCCOCCCC(C)C |
| InChI | InChI=1S/C21H43NO4/c1-19(2)9-5-6-11-21(23)22-12-8-14-25-16-18-26-17-15-24-13-7-10-20(3)4/h19-20H,5-18H2,1-4H3,(H,22,23) |
| InChIKey | BKTUPTSHZPWFRU-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.58 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|