C21H42KNO5 — CID 155739545
potassium 9-[2-[2-[2-(4-methylpentoxy)ethoxy]ethoxy]ethylamino]-9-oxononan-1-olate (PubChem CID 155739545) has the molecular formula C21H42KNO5 and a molecular weight of 427.67 g/mol. Its IUPAC name is potassium 9-[2-[2-[2-(4-methylpentoxy)ethoxy]ethoxy]ethylamino]-9-oxononan-1-olate.
| Compound Name | potassium 9-[2-[2-[2-(4-methylpentoxy)ethoxy]ethoxy]ethylamino]-9-oxononan-1-olate |
|---|---|
| PubChem CID | 155739545 |
| Molecular Formula | C21H42KNO5 |
| Molecular Weight | 427.67 g/mol |
| Exact Mass | 427.27 |
| IUPAC Name | potassium 9-[2-[2-[2-(4-methylpentoxy)ethoxy]ethoxy]ethylamino]-9-oxononan-1-olate |
| SMILES | CC(C)CCCOCCOCCOCCNC(=O)CCCCCCCC[O-].[K+] |
| InChI | InChI=1S/C21H42NO5.K/c1-20(2)10-9-14-25-16-18-27-19-17-26-15-12-22-21(24)11-7-5-3-4-6-8-13-23;/h20H,3-19H2,1-2H3,(H,22,24);/q-1;+1 |
| InChIKey | GMRLSSPGNZALBU-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 79.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.67 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|