C16H32N2O7 — CID 142043664
2-ethoxy-N-[2-[2-[2-[2-[(2-ethoxyacetyl)amino]ethoxy]ethoxy]ethoxy]ethyl]acetamide (PubChem CID 142043664) has the molecular formula C16H32N2O7 and a molecular weight of 364.44 g/mol. Its IUPAC name is 2-ethoxy-N-[2-[2-[2-[2-[(2-ethoxyacetyl)amino]ethoxy]ethoxy]ethoxy]ethyl]acetamide.
| Compound Name | 2-ethoxy-N-[2-[2-[2-[2-[(2-ethoxyacetyl)amino]ethoxy]ethoxy]ethoxy]ethyl]acetamide |
|---|---|
| PubChem CID | 142043664 |
| Molecular Formula | C16H32N2O7 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 2-ethoxy-N-[2-[2-[2-[2-[(2-ethoxyacetyl)amino]ethoxy]ethoxy]ethoxy]ethyl]acetamide |
| SMILES | CCOCC(=O)NCCOCCOCCOCCNC(=O)COCC |
| InChI | InChI=1S/C16H32N2O7/c1-3-21-13-15(19)17-5-7-23-9-11-25-12-10-24-8-6-18-16(20)14-22-4-2/h3-14H2,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | LTHJTSKDBGYTOQ-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 104.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|