C10H19BrN2O4 — CID 90261180
N-[2-[(2-bromoacetyl)amino]ethyl]-2-(2-ethoxyethoxy)acetamide (PubChem CID 90261180) has the molecular formula C10H19BrN2O4 and a molecular weight of 311.18 g/mol. Its IUPAC name is N-[2-[(2-bromoacetyl)amino]ethyl]-2-(2-ethoxyethoxy)acetamide.
| Compound Name | N-[2-[(2-bromoacetyl)amino]ethyl]-2-(2-ethoxyethoxy)acetamide |
|---|---|
| PubChem CID | 90261180 |
| Molecular Formula | C10H19BrN2O4 |
| Molecular Weight | 311.18 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | N-[2-[(2-bromoacetyl)amino]ethyl]-2-(2-ethoxyethoxy)acetamide |
| SMILES | CCOCCOCC(=O)NCCNC(=O)CBr |
| InChI | InChI=1S/C10H19BrN2O4/c1-2-16-5-6-17-8-10(15)13-4-3-12-9(14)7-11/h2-8H2,1H3,(H,12,14)(H,13,15) |
| InChIKey | GJKXUIOQHCBUKV-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.18 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|