C16H30N2O6 — CID 170223089
3-[[2-(2-ethoxyethoxy)acetyl]amino]-N-[2-(3-methyl-2-oxobutoxy)ethyl]propanamide (PubChem CID 170223089) has the molecular formula C16H30N2O6 and a molecular weight of 346.42 g/mol. Its IUPAC name is 3-[[2-(2-ethoxyethoxy)acetyl]amino]-N-[2-(3-methyl-2-oxobutoxy)ethyl]propanamide.
| Compound Name | 3-[[2-(2-ethoxyethoxy)acetyl]amino]-N-[2-(3-methyl-2-oxobutoxy)ethyl]propanamide |
|---|---|
| PubChem CID | 170223089 |
| Molecular Formula | C16H30N2O6 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | 3-[[2-(2-ethoxyethoxy)acetyl]amino]-N-[2-(3-methyl-2-oxobutoxy)ethyl]propanamide |
| SMILES | CCOCCOCC(=O)NCCC(=O)NCCOCC(=O)C(C)C |
| InChI | InChI=1S/C16H30N2O6/c1-4-22-9-10-24-12-16(21)17-6-5-15(20)18-7-8-23-11-14(19)13(2)3/h13H,4-12H2,1-3H3,(H,17,21)(H,18,20) |
| InChIKey | XDOHGXPLIRFOAC-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|