C16H31NO6 — CID 169159624
3-(2-ethoxyethoxy)-N-[2-[2-(3-methyl-2-oxobutoxy)ethoxy]ethyl]propanamide (PubChem CID 169159624) has the molecular formula C16H31NO6 and a molecular weight of 333.43 g/mol. Its IUPAC name is 3-(2-ethoxyethoxy)-N-[2-[2-(3-methyl-2-oxobutoxy)ethoxy]ethyl]propanamide.
| Compound Name | 3-(2-ethoxyethoxy)-N-[2-[2-(3-methyl-2-oxobutoxy)ethoxy]ethyl]propanamide |
|---|---|
| PubChem CID | 169159624 |
| Molecular Formula | C16H31NO6 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | 3-(2-ethoxyethoxy)-N-[2-[2-(3-methyl-2-oxobutoxy)ethoxy]ethyl]propanamide |
| SMILES | CCOCCOCCC(=O)NCCOCCOCC(=O)C(C)C |
| InChI | InChI=1S/C16H31NO6/c1-4-20-9-10-21-7-5-16(19)17-6-8-22-11-12-23-13-15(18)14(2)3/h14H,4-13H2,1-3H3,(H,17,19) |
| InChIKey | ZZSNHJUEROCOHM-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|