C23H42N2O7 — CID 138721605
3-[3-[2-(4-methyl-3-oxohexoxy)ethylamino]-3-oxopropoxy]-N-[2-(4-methyl-3-oxopentoxy)ethyl]propanamide (PubChem CID 138721605) has the molecular formula C23H42N2O7 and a molecular weight of 458.60 g/mol. Its IUPAC name is 3-[3-[2-(4-methyl-3-oxohexoxy)ethylamino]-3-oxopropoxy]-N-[2-(4-methyl-3-oxopentoxy)ethyl]propanamide.
| Compound Name | 3-[3-[2-(4-methyl-3-oxohexoxy)ethylamino]-3-oxopropoxy]-N-[2-(4-methyl-3-oxopentoxy)ethyl]propanamide |
|---|---|
| PubChem CID | 138721605 |
| Molecular Formula | C23H42N2O7 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.30 |
| IUPAC Name | 3-[3-[2-(4-methyl-3-oxohexoxy)ethylamino]-3-oxopropoxy]-N-[2-(4-methyl-3-oxopentoxy)ethyl]propanamide |
| SMILES | CCC(C)C(=O)CCOCCNC(=O)CCOCCC(=O)NCCOCCC(=O)C(C)C |
| InChI | InChI=1S/C23H42N2O7/c1-5-19(4)21(27)7-13-32-17-11-25-23(29)9-15-30-14-8-22(28)24-10-16-31-12-6-20(26)18(2)3/h18-19H,5-17H2,1-4H3,(H,24,28)(H,25,29) |
| InChIKey | IPSSIPQXOFYDDN-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|