C22H40N2O7 — CID 138721623
3-[3-[2-(4-methyl-3-oxoheptoxy)ethylamino]-3-oxopropoxy]-N-[2-(3-oxobutoxy)ethyl]propanamide (PubChem CID 138721623) has the molecular formula C22H40N2O7 and a molecular weight of 444.57 g/mol. Its IUPAC name is 3-[3-[2-(4-methyl-3-oxoheptoxy)ethylamino]-3-oxopropoxy]-N-[2-(3-oxobutoxy)ethyl]propanamide.
| Compound Name | 3-[3-[2-(4-methyl-3-oxoheptoxy)ethylamino]-3-oxopropoxy]-N-[2-(3-oxobutoxy)ethyl]propanamide |
|---|---|
| PubChem CID | 138721623 |
| Molecular Formula | C22H40N2O7 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.28 |
| IUPAC Name | 3-[3-[2-(4-methyl-3-oxoheptoxy)ethylamino]-3-oxopropoxy]-N-[2-(3-oxobutoxy)ethyl]propanamide |
| SMILES | CCCC(C)C(=O)CCOCCNC(=O)CCOCCC(=O)NCCOCCC(C)=O |
| InChI | InChI=1S/C22H40N2O7/c1-4-5-18(2)20(26)7-13-31-17-11-24-22(28)9-15-29-14-8-21(27)23-10-16-30-12-6-19(3)25/h18H,4-17H2,1-3H3,(H,23,27)(H,24,28) |
| InChIKey | QEZROKQOLDJQIL-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|