C19H37NO9 — CID 88581795
N-[2-(2-hydroxyethoxy)ethyl]-3-[2-[2-[2-[2-(3-oxobutoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanamide (PubChem CID 88581795) has the molecular formula C19H37NO9 and a molecular weight of 423.50 g/mol. Its IUPAC name is N-[2-(2-hydroxyethoxy)ethyl]-3-[2-[2-[2-[2-(3-oxobutoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanamide.
| Compound Name | N-[2-(2-hydroxyethoxy)ethyl]-3-[2-[2-[2-[2-(3-oxobutoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanamide |
|---|---|
| PubChem CID | 88581795 |
| Molecular Formula | C19H37NO9 |
| Molecular Weight | 423.50 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | N-[2-(2-hydroxyethoxy)ethyl]-3-[2-[2-[2-[2-(3-oxobutoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanamide |
| SMILES | CC(=O)CCOCCOCCOCCOCCOCCC(=O)NCCOCCO |
| InChI | InChI=1S/C19H37NO9/c1-18(22)2-6-24-10-12-27-14-16-29-17-15-28-13-11-25-7-3-19(23)20-4-8-26-9-5-21/h21H,2-17H2,1H3,(H,20,23) |
| InChIKey | PHZJHYIUNJUQBL-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 121.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.50 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|