C23H45NO8 — CID 170008061
2-methyl-N-[2-[2-[2-[2-[2-[2-(3-methyl-2-oxohexoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]propanamide (PubChem CID 170008061) has the molecular formula C23H45NO8 and a molecular weight of 463.61 g/mol. Its IUPAC name is 2-methyl-N-[2-[2-[2-[2-[2-[2-(3-methyl-2-oxohexoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]propanamide.
| Compound Name | 2-methyl-N-[2-[2-[2-[2-[2-[2-(3-methyl-2-oxohexoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]propanamide |
|---|---|
| PubChem CID | 170008061 |
| Molecular Formula | C23H45NO8 |
| Molecular Weight | 463.61 g/mol |
| Exact Mass | 463.31 |
| IUPAC Name | 2-methyl-N-[2-[2-[2-[2-[2-[2-(3-methyl-2-oxohexoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]propanamide |
| SMILES | CCCC(C)C(=O)COCCOCCOCCOCCOCCOCCNC(=O)C(C)C |
| InChI | InChI=1S/C23H45NO8/c1-5-6-21(4)22(25)19-32-18-17-31-16-15-30-14-13-29-12-11-28-10-9-27-8-7-24-23(26)20(2)3/h20-21H,5-19H2,1-4H3,(H,24,26) |
| InChIKey | GTYLBRTUYMQCIZ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.61 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|