C19H37NO6 — CID 176577667
2-methyl-N-[2-[2-[2-[2-(4-methyl-3-oxopentoxy)ethoxy]ethoxy]ethoxy]ethyl]butanamide (PubChem CID 176577667) has the molecular formula C19H37NO6 and a molecular weight of 375.51 g/mol. Its IUPAC name is 2-methyl-N-[2-[2-[2-[2-(4-methyl-3-oxopentoxy)ethoxy]ethoxy]ethoxy]ethyl]butanamide.
| Compound Name | 2-methyl-N-[2-[2-[2-[2-(4-methyl-3-oxopentoxy)ethoxy]ethoxy]ethoxy]ethyl]butanamide |
|---|---|
| PubChem CID | 176577667 |
| Molecular Formula | C19H37NO6 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.26 |
| IUPAC Name | 2-methyl-N-[2-[2-[2-[2-(4-methyl-3-oxopentoxy)ethoxy]ethoxy]ethoxy]ethyl]butanamide |
| SMILES | CCC(C)C(=O)NCCOCCOCCOCCOCCC(=O)C(C)C |
| InChI | InChI=1S/C19H37NO6/c1-5-17(4)19(22)20-7-9-24-11-13-26-15-14-25-12-10-23-8-6-18(21)16(2)3/h16-17H,5-15H2,1-4H3,(H,20,22) |
| InChIKey | XCRUXWKOGVWPDG-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|