C13H26O4 — CID 140823499
4-methyl-1-[2-(2-propoxyethoxy)ethoxy]pentan-3-one (PubChem CID 140823499) has the molecular formula C13H26O4 and a molecular weight of 246.35 g/mol. Its IUPAC name is 4-methyl-1-[2-(2-propoxyethoxy)ethoxy]pentan-3-one.
| Compound Name | 4-methyl-1-[2-(2-propoxyethoxy)ethoxy]pentan-3-one |
|---|---|
| PubChem CID | 140823499 |
| Molecular Formula | C13H26O4 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | 4-methyl-1-[2-(2-propoxyethoxy)ethoxy]pentan-3-one |
| SMILES | CCCOCCOCCOCCC(=O)C(C)C |
| InChI | InChI=1S/C13H26O4/c1-4-6-15-8-10-17-11-9-16-7-5-13(14)12(2)3/h12H,4-11H2,1-3H3 |
| InChIKey | LYONPHNEVWGUHC-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|