C19H39NO7 — CID 178062676
N-propan-2-yl-3-[2-[2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanamide (PubChem CID 178062676) has the molecular formula C19H39NO7 and a molecular weight of 393.52 g/mol. Its IUPAC name is N-propan-2-yl-3-[2-[2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanamide.
| Compound Name | N-propan-2-yl-3-[2-[2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanamide |
|---|---|
| PubChem CID | 178062676 |
| Molecular Formula | C19H39NO7 |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.27 |
| IUPAC Name | N-propan-2-yl-3-[2-[2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanamide |
| SMILES | CCCOCCOCCOCCOCCOCCOCCC(=O)NC(C)C |
| InChI | InChI=1S/C19H39NO7/c1-4-6-22-8-10-24-12-14-26-16-17-27-15-13-25-11-9-23-7-5-19(21)20-18(2)3/h18H,4-17H2,1-3H3,(H,20,21) |
| InChIKey | MMADVBIYTAMJRM-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|