C20H39N3O6 — CID 170207685
N-[2-[2-[2-[3-oxo-3-(propan-2-ylamino)propoxy]ethoxy]ethoxy]ethyl]-N'-propan-2-ylpentanediamide (PubChem CID 170207685) has the molecular formula C20H39N3O6 and a molecular weight of 417.55 g/mol. Its IUPAC name is N-[2-[2-[2-[3-oxo-3-(propan-2-ylamino)propoxy]ethoxy]ethoxy]ethyl]-N'-propan-2-ylpentanediamide.
| Compound Name | N-[2-[2-[2-[3-oxo-3-(propan-2-ylamino)propoxy]ethoxy]ethoxy]ethyl]-N'-propan-2-ylpentanediamide |
|---|---|
| PubChem CID | 170207685 |
| Molecular Formula | C20H39N3O6 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.28 |
| IUPAC Name | N-[2-[2-[2-[3-oxo-3-(propan-2-ylamino)propoxy]ethoxy]ethoxy]ethyl]-N'-propan-2-ylpentanediamide |
| SMILES | CC(C)NC(=O)CCCC(=O)NCCOCCOCCOCCC(=O)NC(C)C |
| InChI | InChI=1S/C20H39N3O6/c1-16(2)22-19(25)7-5-6-18(24)21-9-11-28-13-15-29-14-12-27-10-8-20(26)23-17(3)4/h16-17H,5-15H2,1-4H3,(H,21,24)(H,22,25)(H,23,26) |
| InChIKey | YOPKVHHKEKPQAL-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|