C12H29NO3 — CID 178062930
ethane;3-(2-ethoxyethoxy)-N-propan-2-ylpropanamide;molecular hydrogen (PubChem CID 178062930) has the molecular formula C12H29NO3 and a molecular weight of 235.37 g/mol. Its IUPAC name is ethane;3-(2-ethoxyethoxy)-N-propan-2-ylpropanamide;molecular hydrogen.
| Compound Name | ethane;3-(2-ethoxyethoxy)-N-propan-2-ylpropanamide;molecular hydrogen |
|---|---|
| PubChem CID | 178062930 |
| Molecular Formula | C12H29NO3 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.21 |
| IUPAC Name | ethane;3-(2-ethoxyethoxy)-N-propan-2-ylpropanamide;molecular hydrogen |
| SMILES | CC.CCOCCOCCC(=O)NC(C)C.[H][H] |
| InChI | InChI=1S/C10H21NO3.C2H6.H2/c1-4-13-7-8-14-6-5-10(12)11-9(2)3;1-2;/h9H,4-8H2,1-3H3,(H,11,12);1-2H3;1H |
| InChIKey | FOKBXXIYCRDJRC-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|