C12H25NO4 — CID 144855445
N-ethyl-3-[2-(2-propoxyethoxy)ethoxy]propanamide (PubChem CID 144855445) has the molecular formula C12H25NO4 and a molecular weight of 247.33 g/mol. Its IUPAC name is N-ethyl-3-[2-(2-propoxyethoxy)ethoxy]propanamide.
| Compound Name | N-ethyl-3-[2-(2-propoxyethoxy)ethoxy]propanamide |
|---|---|
| PubChem CID | 144855445 |
| Molecular Formula | C12H25NO4 |
| Molecular Weight | 247.33 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | N-ethyl-3-[2-(2-propoxyethoxy)ethoxy]propanamide |
| SMILES | CCCOCCOCCOCCC(=O)NCC |
| InChI | InChI=1S/C12H25NO4/c1-3-6-15-8-10-17-11-9-16-7-5-12(14)13-4-2/h3-11H2,1-2H3,(H,13,14) |
| InChIKey | NUIUAKPQHJNHFD-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.33 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|