C13H31N3O4 — CID 158863461
3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]-N-ethylpropanamide;ethanamine (PubChem CID 158863461) has the molecular formula C13H31N3O4 and a molecular weight of 293.41 g/mol. Its IUPAC name is 3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]-N-ethylpropanamide;ethanamine.
| Compound Name | 3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]-N-ethylpropanamide;ethanamine |
|---|---|
| PubChem CID | 158863461 |
| Molecular Formula | C13H31N3O4 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.23 |
| IUPAC Name | 3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]-N-ethylpropanamide;ethanamine |
| SMILES | CCN.CCNC(=O)CCOCCOCCOCCN |
| InChI | InChI=1S/C11H24N2O4.C2H7N/c1-2-13-11(14)3-5-15-7-9-17-10-8-16-6-4-12;1-2-3/h2-10,12H2,1H3,(H,13,14);2-3H2,1H3 |
| InChIKey | JAXXQYAJKUBNFZ-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|