C13H28N2O7 — CID 172598015
2-[3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]propanoylamino]acetic acid;methoxymethane (PubChem CID 172598015) has the molecular formula C13H28N2O7 and a molecular weight of 324.37 g/mol. Its IUPAC name is 2-[3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]propanoylamino]acetic acid;methoxymethane.
| Compound Name | 2-[3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]propanoylamino]acetic acid;methoxymethane |
|---|---|
| PubChem CID | 172598015 |
| Molecular Formula | C13H28N2O7 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | 2-[3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]propanoylamino]acetic acid;methoxymethane |
| SMILES | COC.NCCOCCOCCOCCC(=O)NCC(=O)O |
| InChI | InChI=1S/C11H22N2O6.C2H6O/c12-2-4-18-6-8-19-7-5-17-3-1-10(14)13-9-11(15)16;1-3-2/h1-9,12H2,(H,13,14)(H,15,16);1-2H3 |
| InChIKey | BDVTZGMXTURTTD-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 129.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|