C18H38N2O7 — CID 176761961
3-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-N-propylpropanamide (PubChem CID 176761961) has the molecular formula C18H38N2O7 and a molecular weight of 394.51 g/mol. Its IUPAC name is 3-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-N-propylpropanamide.
| Compound Name | 3-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-N-propylpropanamide |
|---|---|
| PubChem CID | 176761961 |
| Molecular Formula | C18H38N2O7 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | 3-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-N-propylpropanamide |
| SMILES | CCCNC(=O)CCOCCOCCOCCOCCOCCOCCN |
| InChI | InChI=1S/C18H38N2O7/c1-2-5-20-18(21)3-6-22-8-10-24-12-14-26-16-17-27-15-13-25-11-9-23-7-4-19/h2-17,19H2,1H3,(H,20,21) |
| InChIKey | HEQJOTCZRKHKCX-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 110.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|