C8H18N2O2 — CID 62344045
3-(3-aminopropoxy)-N-ethylpropanamide (PubChem CID 62344045) has the molecular formula C8H18N2O2 and a molecular weight of 174.24 g/mol. Its IUPAC name is 3-(3-aminopropoxy)-N-ethylpropanamide.
| Compound Name | 3-(3-aminopropoxy)-N-ethylpropanamide |
|---|---|
| PubChem CID | 62344045 |
| Molecular Formula | C8H18N2O2 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | 3-(3-aminopropoxy)-N-ethylpropanamide |
| SMILES | CCNC(=O)CCOCCCN |
| InChI | InChI=1S/C8H18N2O2/c1-2-10-8(11)4-7-12-6-3-5-9/h2-7,9H2,1H3,(H,10,11) |
| InChIKey | ZNYXMKLUPFVTGQ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|