C19H40N2O7 — CID 145188206
4-amino-N-[2-[2-[2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]butanamide (PubChem CID 145188206) has the molecular formula C19H40N2O7 and a molecular weight of 408.54 g/mol. Its IUPAC name is 4-amino-N-[2-[2-[2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]butanamide.
| Compound Name | 4-amino-N-[2-[2-[2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]butanamide |
|---|---|
| PubChem CID | 145188206 |
| Molecular Formula | C19H40N2O7 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.28 |
| IUPAC Name | 4-amino-N-[2-[2-[2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]butanamide |
| SMILES | CCCOCCOCCOCCOCCOCCOCCNC(=O)CCCN |
| InChI | InChI=1S/C19H40N2O7/c1-2-7-23-9-11-25-13-15-27-17-18-28-16-14-26-12-10-24-8-6-21-19(22)4-3-5-20/h2-18,20H2,1H3,(H,21,22) |
| InChIKey | FRQBDSKWDZAVOH-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 110.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|