C19H39NO5 — CID 178008137
4,5-dimethyl-N-[2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethyl]hexanamide (PubChem CID 178008137) has the molecular formula C19H39NO5 and a molecular weight of 361.52 g/mol. Its IUPAC name is 4,5-dimethyl-N-[2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethyl]hexanamide.
| Compound Name | 4,5-dimethyl-N-[2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethyl]hexanamide |
|---|---|
| PubChem CID | 178008137 |
| Molecular Formula | C19H39NO5 |
| Molecular Weight | 361.52 g/mol |
| Exact Mass | 361.28 |
| IUPAC Name | 4,5-dimethyl-N-[2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethyl]hexanamide |
| SMILES | CCCOCCOCCOCCOCCNC(=O)CCC(C)C(C)C |
| InChI | InChI=1S/C19H39NO5/c1-5-9-22-11-13-24-15-16-25-14-12-23-10-8-20-19(21)7-6-18(4)17(2)3/h17-18H,5-16H2,1-4H3,(H,20,21) |
| InChIKey | GEYUWOOOSPASFG-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.52 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|