C15H32N2O3S — CID 156649796
2-(2,3-dimethylbutylamino)sulfanyl-N-[2-(2-propoxyethoxy)ethyl]acetamide (PubChem CID 156649796) has the molecular formula C15H32N2O3S and a molecular weight of 320.50 g/mol. Its IUPAC name is 2-(2,3-dimethylbutylamino)sulfanyl-N-[2-(2-propoxyethoxy)ethyl]acetamide.
| Compound Name | 2-(2,3-dimethylbutylamino)sulfanyl-N-[2-(2-propoxyethoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 156649796 |
| Molecular Formula | C15H32N2O3S |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | 2-(2,3-dimethylbutylamino)sulfanyl-N-[2-(2-propoxyethoxy)ethyl]acetamide |
| SMILES | CCCOCCOCCNC(=O)CSNCC(C)C(C)C |
| InChI | InChI=1S/C15H32N2O3S/c1-5-7-19-9-10-20-8-6-16-15(18)12-21-17-11-14(4)13(2)3/h13-14,17H,5-12H2,1-4H3,(H,16,18) |
| InChIKey | OPVPXXONYLOUDE-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|