C16H33NO8 — CID 123981606
2-[2-[2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethylcarbamic acid (PubChem CID 123981606) has the molecular formula C16H33NO8 and a molecular weight of 367.44 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethylcarbamic acid.
| Compound Name | 2-[2-[2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethylcarbamic acid |
|---|---|
| PubChem CID | 123981606 |
| Molecular Formula | C16H33NO8 |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.22 |
| IUPAC Name | 2-[2-[2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethylcarbamic acid |
| SMILES | CCCOCCOCCOCCOCCOCCOCCNC(=O)O |
| InChI | InChI=1S/C16H33NO8/c1-2-4-20-6-8-22-10-12-24-14-15-25-13-11-23-9-7-21-5-3-17-16(18)19/h17H,2-15H2,1H3,(H,18,19) |
| InChIKey | NEPXXLVULWHGJS-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 104.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|