C15H30N2O7 — CID 143180051
2-[3-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]propanoylamino]ethylcarbamic acid (PubChem CID 143180051) has the molecular formula C15H30N2O7 and a molecular weight of 350.41 g/mol. Its IUPAC name is 2-[3-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]propanoylamino]ethylcarbamic acid.
| Compound Name | 2-[3-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]propanoylamino]ethylcarbamic acid |
|---|---|
| PubChem CID | 143180051 |
| Molecular Formula | C15H30N2O7 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 2-[3-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]propanoylamino]ethylcarbamic acid |
| SMILES | CCCOCCOCCOCCOCCC(=O)NCCNC(=O)O |
| InChI | InChI=1S/C15H30N2O7/c1-2-6-21-8-10-23-12-13-24-11-9-22-7-3-14(18)16-4-5-17-15(19)20/h17H,2-13H2,1H3,(H,16,18)(H,19,20) |
| InChIKey | DJULHXTZXYDNQS-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 115.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|