C18H39NO6 — CID 176987409
N-[2-[2-(2-butoxyethoxy)ethoxy]ethyl]-3-(2-propoxyethoxy)propanamide;molecular hydrogen (PubChem CID 176987409) has the molecular formula C18H39NO6 and a molecular weight of 365.51 g/mol. Its IUPAC name is N-[2-[2-(2-butoxyethoxy)ethoxy]ethyl]-3-(2-propoxyethoxy)propanamide;molecular hydrogen.
| Compound Name | N-[2-[2-(2-butoxyethoxy)ethoxy]ethyl]-3-(2-propoxyethoxy)propanamide;molecular hydrogen |
|---|---|
| PubChem CID | 176987409 |
| Molecular Formula | C18H39NO6 |
| Molecular Weight | 365.51 g/mol |
| Exact Mass | 365.28 |
| IUPAC Name | N-[2-[2-(2-butoxyethoxy)ethoxy]ethyl]-3-(2-propoxyethoxy)propanamide;molecular hydrogen |
| SMILES | CCCCOCCOCCOCCNC(=O)CCOCCOCCC.[H][H] |
| InChI | InChI=1S/C18H37NO6.H2/c1-3-5-9-22-13-16-25-17-15-24-11-7-19-18(20)6-10-23-14-12-21-8-4-2;/h3-17H2,1-2H3,(H,19,20);1H |
| InChIKey | HGWZSSBVZLSTAN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.51 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|