C9H20N2O4 — CID 126503687
2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethylcarbamic acid (PubChem CID 126503687) has the molecular formula C9H20N2O4 and a molecular weight of 220.27 g/mol. Its IUPAC name is 2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethylcarbamic acid.
| Compound Name | 2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethylcarbamic acid |
|---|---|
| PubChem CID | 126503687 |
| Molecular Formula | C9H20N2O4 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | 2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethylcarbamic acid |
| SMILES | CN(C)CCOCCOCCNC(=O)O |
| InChI | InChI=1S/C9H20N2O4/c1-11(2)4-6-15-8-7-14-5-3-10-9(12)13/h10H,3-8H2,1-2H3,(H,12,13) |
| InChIKey | CYHOLKMSCMOKKD-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|