C6H14N2O4 — CID 174189370
2-[2-[hydroxy(methyl)amino]ethoxy]ethylcarbamic acid (PubChem CID 174189370) has the molecular formula C6H14N2O4 and a molecular weight of 178.19 g/mol. Its IUPAC name is 2-[2-[hydroxy(methyl)amino]ethoxy]ethylcarbamic acid.
| Compound Name | 2-[2-[hydroxy(methyl)amino]ethoxy]ethylcarbamic acid |
|---|---|
| PubChem CID | 174189370 |
| Molecular Formula | C6H14N2O4 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 2-[2-[hydroxy(methyl)amino]ethoxy]ethylcarbamic acid |
| SMILES | CN(O)CCOCCNC(=O)O |
| InChI | InChI=1S/C6H14N2O4/c1-8(11)3-5-12-4-2-7-6(9)10/h7,11H,2-5H2,1H3,(H,9,10) |
| InChIKey | BIBZDONUGKAITE-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|