C15H33NO3 — CID 176934514
ethene;N-[2-[2-(3-methylbutoxy)ethoxy]ethyl]butanamide;molecular hydrogen (PubChem CID 176934514) has the molecular formula C15H33NO3 and a molecular weight of 275.43 g/mol. Its IUPAC name is ethene;N-[2-[2-(3-methylbutoxy)ethoxy]ethyl]butanamide;molecular hydrogen.
| Compound Name | ethene;N-[2-[2-(3-methylbutoxy)ethoxy]ethyl]butanamide;molecular hydrogen |
|---|---|
| PubChem CID | 176934514 |
| Molecular Formula | C15H33NO3 |
| Molecular Weight | 275.43 g/mol |
| Exact Mass | 275.25 |
| IUPAC Name | ethene;N-[2-[2-(3-methylbutoxy)ethoxy]ethyl]butanamide;molecular hydrogen |
| SMILES | C=C.CCCC(=O)NCCOCCOCCC(C)C.[H][H] |
| InChI | InChI=1S/C13H27NO3.C2H4.H2/c1-4-5-13(15)14-7-9-17-11-10-16-8-6-12(2)3;1-2;/h12H,4-11H2,1-3H3,(H,14,15);1-2H2;1H |
| InChIKey | PPAWDJFJOUWZGO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.43 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|