C18H41NO3 — CID 170613092
ethane;N-hexyl-3-[2-(3-methylbutoxy)ethoxy]propanamide;molecular hydrogen (PubChem CID 170613092) has the molecular formula C18H41NO3 and a molecular weight of 319.53 g/mol. Its IUPAC name is ethane;N-hexyl-3-[2-(3-methylbutoxy)ethoxy]propanamide;molecular hydrogen.
| Compound Name | ethane;N-hexyl-3-[2-(3-methylbutoxy)ethoxy]propanamide;molecular hydrogen |
|---|---|
| PubChem CID | 170613092 |
| Molecular Formula | C18H41NO3 |
| Molecular Weight | 319.53 g/mol |
| Exact Mass | 319.31 |
| IUPAC Name | ethane;N-hexyl-3-[2-(3-methylbutoxy)ethoxy]propanamide;molecular hydrogen |
| SMILES | CC.CCCCCCNC(=O)CCOCCOCCC(C)C.[H][H] |
| InChI | InChI=1S/C16H33NO3.C2H6.H2/c1-4-5-6-7-10-17-16(18)9-12-20-14-13-19-11-8-15(2)3;1-2;/h15H,4-14H2,1-3H3,(H,17,18);1-2H3;1H |
| InChIKey | RGCIRODEASLAEL-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.53 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|