About ethane;molecular hydrogen;N-pentyltridecanamide
ethane;molecular hydrogen;N-pentyltridecanamide (PubChem CID 142045594) has the molecular formula C20H45NO
and a molecular weight of 315.59 g/mol. Its IUPAC name is ethane;molecular hydrogen;N-pentyltridecanamide.
Molecular Properties
| Compound Name | ethane;molecular hydrogen;N-pentyltridecanamide |
| PubChem CID | 142045594 |
| Molecular Formula | C20H45NO |
| Molecular Weight | 315.59 g/mol |
| Exact Mass | 315.35 |
| IUPAC Name | ethane;molecular hydrogen;N-pentyltridecanamide |
| SMILES | CC.CCCCCCCCCCCCC(=O)NCCCCC.[H][H] |
| InChI | InChI=1S/C18H37NO.C2H6.H2/c1-3-5-7-8-9-10-11-12-13-14-16-18(20)19-17-15-6-4-2;1-2;/h3-17H2,1-2H3,(H,19,20);1-2H3;1H |
| InChIKey | AGNNRSDTZLWQHE-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 315.59 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;molecular hydrogen;N-pentyltridecanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;molecular hydrogen;N-pentyltridecanamide?
The IUPAC name of ethane;molecular hydrogen;N-pentyltridecanamide (CID 142045594) is ethane;molecular hydrogen;N-pentyltridecanamide.
What is the SMILES notation for ethane;molecular hydrogen;N-pentyltridecanamide?
The canonical SMILES for ethane;molecular hydrogen;N-pentyltridecanamide is CC.CCCCCCCCCCCCC(=O)NCCCCC.[H][H].
What is the InChIKey of ethane;molecular hydrogen;N-pentyltridecanamide?
The InChIKey is AGNNRSDTZLWQHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H37NO.C2H6.H2/c1-3-5-7-8-9-10-11-12-13-14-16-18(20)19-17-15-6-4-2;1-2;/h3-17H2,1-2H3,(H,19,20);1-2H3;1H.
What are the key properties of ethane;molecular hydrogen;N-pentyltridecanamide?
ethane;molecular hydrogen;N-pentyltridecanamide has a molecular weight of 315.59 g/mol, XLogP of 6.88, 15 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;molecular hydrogen;N-pentyltridecanamide is sourced from PubChem (CID 142045594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).