C13H28NO3Y- — CID 153336214
N-[2-(2-methanidyloxyethoxy)ethyl]butanamide;2-methylpropane;yttrium (PubChem CID 153336214) has the molecular formula C13H28NO3Y- and a molecular weight of 335.28 g/mol. Its IUPAC name is N-[2-(2-methanidyloxyethoxy)ethyl]butanamide;2-methylpropane;yttrium.
| Compound Name | N-[2-(2-methanidyloxyethoxy)ethyl]butanamide;2-methylpropane;yttrium |
|---|---|
| PubChem CID | 153336214 |
| Molecular Formula | C13H28NO3Y- |
| Molecular Weight | 335.28 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | N-[2-(2-methanidyloxyethoxy)ethyl]butanamide;2-methylpropane;yttrium |
| SMILES | CC(C)C.[CH2-]OCCOCCNC(=O)CCC.[Y] |
| InChI | InChI=1S/C9H18NO3.C4H10.Y/c1-3-4-9(11)10-5-6-13-8-7-12-2;1-4(2)3;/h2-8H2,1H3,(H,10,11);4H,1-3H3;/q-1;; |
| InChIKey | ZPYPGYOFZAKCRT-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|