C13H30N2O3 — CID 155748733
2-amino-N-[2-[2-(3-methylbutoxy)ethoxy]ethyl]acetamide;ethane (PubChem CID 155748733) has the molecular formula C13H30N2O3 and a molecular weight of 262.39 g/mol. Its IUPAC name is 2-amino-N-[2-[2-(3-methylbutoxy)ethoxy]ethyl]acetamide;ethane.
| Compound Name | 2-amino-N-[2-[2-(3-methylbutoxy)ethoxy]ethyl]acetamide;ethane |
|---|---|
| PubChem CID | 155748733 |
| Molecular Formula | C13H30N2O3 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.23 |
| IUPAC Name | 2-amino-N-[2-[2-(3-methylbutoxy)ethoxy]ethyl]acetamide;ethane |
| SMILES | CC.CC(C)CCOCCOCCNC(=O)CN |
| InChI | InChI=1S/C11H24N2O3.C2H6/c1-10(2)3-5-15-7-8-16-6-4-13-11(14)9-12;1-2/h10H,3-9,12H2,1-2H3,(H,13,14);1-2H3 |
| InChIKey | UMLSKSMXEHQZAT-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|