C19H39NO5S — CID 156547182
N-[2-[2-[2-[2-(3-methylbutoxy)ethoxy]ethoxy]ethoxy]ethyl]-2-(2-methylpropylsulfanyl)acetamide (PubChem CID 156547182) has the molecular formula C19H39NO5S and a molecular weight of 393.59 g/mol. Its IUPAC name is N-[2-[2-[2-[2-(3-methylbutoxy)ethoxy]ethoxy]ethoxy]ethyl]-2-(2-methylpropylsulfanyl)acetamide.
| Compound Name | N-[2-[2-[2-[2-(3-methylbutoxy)ethoxy]ethoxy]ethoxy]ethyl]-2-(2-methylpropylsulfanyl)acetamide |
|---|---|
| PubChem CID | 156547182 |
| Molecular Formula | C19H39NO5S |
| Molecular Weight | 393.59 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | N-[2-[2-[2-[2-(3-methylbutoxy)ethoxy]ethoxy]ethoxy]ethyl]-2-(2-methylpropylsulfanyl)acetamide |
| SMILES | CC(C)CCOCCOCCOCCOCCNC(=O)CSCC(C)C |
| InChI | InChI=1S/C19H39NO5S/c1-17(2)5-7-22-9-11-24-13-14-25-12-10-23-8-6-20-19(21)16-26-15-18(3)4/h17-18H,5-16H2,1-4H3,(H,20,21) |
| InChIKey | OIHZBALVAOMLCE-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.59 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|