C14H29N3O3 — CID 82961460
(2S)-2-amino-3-methyl-N-[2-[2-(3-methylbutoxy)ethylamino]-2-oxoethyl]butanamide (PubChem CID 82961460) has the molecular formula C14H29N3O3 and a molecular weight of 287.40 g/mol. Its IUPAC name is (2S)-2-amino-3-methyl-N-[2-[2-(3-methylbutoxy)ethylamino]-2-oxoethyl]butanamide.
| Compound Name | (2S)-2-amino-3-methyl-N-[2-[2-(3-methylbutoxy)ethylamino]-2-oxoethyl]butanamide |
|---|---|
| PubChem CID | 82961460 |
| Molecular Formula | C14H29N3O3 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | (2S)-2-amino-3-methyl-N-[2-[2-(3-methylbutoxy)ethylamino]-2-oxoethyl]butanamide |
| SMILES | CC(C)CCOCCNC(=O)CNC(=O)[C@@H](N)C(C)C |
| InChI | InChI=1S/C14H29N3O3/c1-10(2)5-7-20-8-6-16-12(18)9-17-14(19)13(15)11(3)4/h10-11,13H,5-9,15H2,1-4H3,(H,16,18)(H,17,19)/t13-/m0/s1 |
| InChIKey | HIVQPOQCNSGWQD-ZDUSSCGKSA-N |
| XLogP | 0.26 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|