C13H25N3O4 — CID 82962195
ethyl 4-[[2-[[(2S)-2-amino-3-methylbutanoyl]amino]acetyl]amino]butanoate (PubChem CID 82962195) has the molecular formula C13H25N3O4 and a molecular weight of 287.36 g/mol. Its IUPAC name is ethyl 4-[[2-[[(2S)-2-amino-3-methylbutanoyl]amino]acetyl]amino]butanoate.
| Compound Name | ethyl 4-[[2-[[(2S)-2-amino-3-methylbutanoyl]amino]acetyl]amino]butanoate |
|---|---|
| PubChem CID | 82962195 |
| Molecular Formula | C13H25N3O4 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.18 |
| IUPAC Name | ethyl 4-[[2-[[(2S)-2-amino-3-methylbutanoyl]amino]acetyl]amino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)CNC(=O)[C@@H](N)C(C)C |
| InChI | InChI=1S/C13H25N3O4/c1-4-20-11(18)6-5-7-15-10(17)8-16-13(19)12(14)9(2)3/h9,12H,4-8,14H2,1-3H3,(H,15,17)(H,16,19)/t12-/m0/s1 |
| InChIKey | HCEBGVRRNYRXJZ-LBPRGKRZSA-N |
| XLogP | -0.45 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|