C18H38N4O2 — CID 101248769
(2S)-2-amino-N-[8-[[(2S)-2-amino-3-methylbutanoyl]amino]octyl]-3-methylbutanamide (PubChem CID 101248769) has the molecular formula C18H38N4O2 and a molecular weight of 342.53 g/mol. Its IUPAC name is (2S)-2-amino-N-[8-[[(2S)-2-amino-3-methylbutanoyl]amino]octyl]-3-methylbutanamide.
| Compound Name | (2S)-2-amino-N-[8-[[(2S)-2-amino-3-methylbutanoyl]amino]octyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 101248769 |
| Molecular Formula | C18H38N4O2 |
| Molecular Weight | 342.53 g/mol |
| Exact Mass | 342.30 |
| IUPAC Name | (2S)-2-amino-N-[8-[[(2S)-2-amino-3-methylbutanoyl]amino]octyl]-3-methylbutanamide |
| SMILES | CC(C)[C@H](N)C(=O)NCCCCCCCCNC(=O)[C@@H](N)C(C)C |
| InChI | InChI=1S/C18H38N4O2/c1-13(2)15(19)17(23)21-11-9-7-5-6-8-10-12-22-18(24)16(20)14(3)4/h13-16H,5-12,19-20H2,1-4H3,(H,21,23)(H,22,24)/t15-,16-/m0/s1 |
| InChIKey | GRPRSNMBDUJSDM-HOTGVXAUSA-N |
| XLogP | 1.53 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.53 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|