C10H24N2O — CID 143224871
2-amino-3-methyl-N-propylbutanamide;ethane (PubChem CID 143224871) has the molecular formula C10H24N2O and a molecular weight of 188.31 g/mol. Its IUPAC name is 2-amino-3-methyl-N-propylbutanamide;ethane.
| Compound Name | 2-amino-3-methyl-N-propylbutanamide;ethane |
|---|---|
| PubChem CID | 143224871 |
| Molecular Formula | C10H24N2O |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.19 |
| IUPAC Name | 2-amino-3-methyl-N-propylbutanamide;ethane |
| SMILES | CC.CCCNC(=O)C(N)C(C)C |
| InChI | InChI=1S/C8H18N2O.C2H6/c1-4-5-10-8(11)7(9)6(2)3;1-2/h6-7H,4-5,9H2,1-3H3,(H,10,11);1-2H3 |
| InChIKey | DIJYAWJLXHECJD-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |