C11H24N2O2 — CID 79012909
(2R)-2-amino-3-methyl-N-(3-propan-2-yloxypropyl)butanamide (PubChem CID 79012909) has the molecular formula C11H24N2O2 and a molecular weight of 216.32 g/mol. Its IUPAC name is (2R)-2-amino-3-methyl-N-(3-propan-2-yloxypropyl)butanamide.
| Compound Name | (2R)-2-amino-3-methyl-N-(3-propan-2-yloxypropyl)butanamide |
|---|---|
| PubChem CID | 79012909 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | (2R)-2-amino-3-methyl-N-(3-propan-2-yloxypropyl)butanamide |
| SMILES | CC(C)OCCCNC(=O)[C@H](N)C(C)C |
| InChI | InChI=1S/C11H24N2O2/c1-8(2)10(12)11(14)13-6-5-7-15-9(3)4/h8-10H,5-7,12H2,1-4H3,(H,13,14)/t10-/m1/s1 |
| InChIKey | LXZRBRFSXORVOF-SNVBAGLBSA-N |
| XLogP | 0.90 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|