C14H29N3O6 — CID 123400101
2-[2-[2-[[2-[2-(2-aminoethoxy)ethoxy]acetyl]amino]ethoxy]ethoxy]-N-ethylacetamide (PubChem CID 123400101) has the molecular formula C14H29N3O6 and a molecular weight of 335.40 g/mol. Its IUPAC name is 2-[2-[2-[[2-[2-(2-aminoethoxy)ethoxy]acetyl]amino]ethoxy]ethoxy]-N-ethylacetamide.
| Compound Name | 2-[2-[2-[[2-[2-(2-aminoethoxy)ethoxy]acetyl]amino]ethoxy]ethoxy]-N-ethylacetamide |
|---|---|
| PubChem CID | 123400101 |
| Molecular Formula | C14H29N3O6 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | 2-[2-[2-[[2-[2-(2-aminoethoxy)ethoxy]acetyl]amino]ethoxy]ethoxy]-N-ethylacetamide |
| SMILES | CCNC(=O)COCCOCCNC(=O)COCCOCCN |
| InChI | InChI=1S/C14H29N3O6/c1-2-16-13(18)11-22-10-8-21-6-4-17-14(19)12-23-9-7-20-5-3-15/h2-12,15H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | FYQGNVYGBLKPEI-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 121.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|