C24H47NO5 — CID 163268696
1-[2-(tert-butylamino)-2-[(4-methyl-3-oxopentoxy)methyl]-3-propoxypropoxy]-4,4-dimethylpentan-3-one (PubChem CID 163268696) has the molecular formula C24H47NO5 and a molecular weight of 429.64 g/mol. Its IUPAC name is 1-[2-(tert-butylamino)-2-[(4-methyl-3-oxopentoxy)methyl]-3-propoxypropoxy]-4,4-dimethylpentan-3-one.
| Compound Name | 1-[2-(tert-butylamino)-2-[(4-methyl-3-oxopentoxy)methyl]-3-propoxypropoxy]-4,4-dimethylpentan-3-one |
|---|---|
| PubChem CID | 163268696 |
| Molecular Formula | C24H47NO5 |
| Molecular Weight | 429.64 g/mol |
| Exact Mass | 429.35 |
| IUPAC Name | 1-[2-(tert-butylamino)-2-[(4-methyl-3-oxopentoxy)methyl]-3-propoxypropoxy]-4,4-dimethylpentan-3-one |
| SMILES | CCCOCC(COCCC(=O)C(C)C)(COCCC(=O)C(C)(C)C)NC(C)(C)C |
| InChI | InChI=1S/C24H47NO5/c1-10-13-28-16-24(25-23(7,8)9,17-29-14-11-20(26)19(2)3)18-30-15-12-21(27)22(4,5)6/h19,25H,10-18H2,1-9H3 |
| InChIKey | XJSRMNMBDVMVLK-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.64 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|