C21H41NO4 — CID 163420019
1-[2-(tert-butylamino)-3-(4,4-dimethyl-3-oxopentoxy)propoxy]-4,4-dimethylpentan-3-one (PubChem CID 163420019) has the molecular formula C21H41NO4 and a molecular weight of 371.56 g/mol. Its IUPAC name is 1-[2-(tert-butylamino)-3-(4,4-dimethyl-3-oxopentoxy)propoxy]-4,4-dimethylpentan-3-one.
| Compound Name | 1-[2-(tert-butylamino)-3-(4,4-dimethyl-3-oxopentoxy)propoxy]-4,4-dimethylpentan-3-one |
|---|---|
| PubChem CID | 163420019 |
| Molecular Formula | C21H41NO4 |
| Molecular Weight | 371.56 g/mol |
| Exact Mass | 371.30 |
| IUPAC Name | 1-[2-(tert-butylamino)-3-(4,4-dimethyl-3-oxopentoxy)propoxy]-4,4-dimethylpentan-3-one |
| SMILES | CC(C)(C)NC(COCCC(=O)C(C)(C)C)COCCC(=O)C(C)(C)C |
| InChI | InChI=1S/C21H41NO4/c1-19(2,3)17(23)10-12-25-14-16(22-21(7,8)9)15-26-13-11-18(24)20(4,5)6/h16,22H,10-15H2,1-9H3 |
| InChIKey | IHWRYQOUUWNORS-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.56 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|