C17H33NO2 — CID 140940119
(4S)-4-(tert-butylamino)-2,2,8,8-tetramethylnonane-3,7-dione (PubChem CID 140940119) has the molecular formula C17H33NO2 and a molecular weight of 283.46 g/mol. Its IUPAC name is (4S)-4-(tert-butylamino)-2,2,8,8-tetramethylnonane-3,7-dione.
| Compound Name | (4S)-4-(tert-butylamino)-2,2,8,8-tetramethylnonane-3,7-dione |
|---|---|
| PubChem CID | 140940119 |
| Molecular Formula | C17H33NO2 |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.25 |
| IUPAC Name | (4S)-4-(tert-butylamino)-2,2,8,8-tetramethylnonane-3,7-dione |
| SMILES | CC(C)(C)N[C@@H](CCC(=O)C(C)(C)C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C17H33NO2/c1-15(2,3)13(19)11-10-12(18-17(7,8)9)14(20)16(4,5)6/h12,18H,10-11H2,1-9H3/t12-/m0/s1 |
| InChIKey | YLXHCIFWWBEUOX-LBPRGKRZSA-N |
| XLogP | 3.75 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |