C25H45IN2O4 — CID 166965355
4-(tert-butylamino)-N-(2-iodo-2,8,8-trimethyl-3,7-dioxononan-4-yl)-6,6-dimethyl-5-oxoheptanamide (PubChem CID 166965355) has the molecular formula C25H45IN2O4 and a molecular weight of 564.55 g/mol. Its IUPAC name is 4-(tert-butylamino)-N-(2-iodo-2,8,8-trimethyl-3,7-dioxononan-4-yl)-6,6-dimethyl-5-oxoheptanamide.
| Compound Name | 4-(tert-butylamino)-N-(2-iodo-2,8,8-trimethyl-3,7-dioxononan-4-yl)-6,6-dimethyl-5-oxoheptanamide |
|---|---|
| PubChem CID | 166965355 |
| Molecular Formula | C25H45IN2O4 |
| Molecular Weight | 564.55 g/mol |
| Exact Mass | 564.24 |
| IUPAC Name | 4-(tert-butylamino)-N-(2-iodo-2,8,8-trimethyl-3,7-dioxononan-4-yl)-6,6-dimethyl-5-oxoheptanamide |
| SMILES | CC(C)(C)NC(CCC(=O)NC(CCC(=O)C(C)(C)C)C(=O)C(C)(C)I)C(=O)C(C)(C)C |
| InChI | InChI=1S/C25H45IN2O4/c1-22(2,3)18(29)14-12-16(21(32)25(10,11)26)27-19(30)15-13-17(28-24(7,8)9)20(31)23(4,5)6/h16-17,28H,12-15H2,1-11H3,(H,27,30) |
| InChIKey | WDUPMORBLORCRQ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.55 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|