C31H57N3O5 — CID 171419319
N-[6-(tert-butylamino)-1-oxo-1-[(2,2,8,8-tetramethyl-3,7-dioxononan-4-yl)amino]hexan-2-yl]-5,5-dimethyl-4-oxohexanamide (PubChem CID 171419319) has the molecular formula C31H57N3O5 and a molecular weight of 551.81 g/mol. Its IUPAC name is N-[6-(tert-butylamino)-1-oxo-1-[(2,2,8,8-tetramethyl-3,7-dioxononan-4-yl)amino]hexan-2-yl]-5,5-dimethyl-4-oxohexanamide.
| Compound Name | N-[6-(tert-butylamino)-1-oxo-1-[(2,2,8,8-tetramethyl-3,7-dioxononan-4-yl)amino]hexan-2-yl]-5,5-dimethyl-4-oxohexanamide |
|---|---|
| PubChem CID | 171419319 |
| Molecular Formula | C31H57N3O5 |
| Molecular Weight | 551.81 g/mol |
| Exact Mass | 551.43 |
| IUPAC Name | N-[6-(tert-butylamino)-1-oxo-1-[(2,2,8,8-tetramethyl-3,7-dioxononan-4-yl)amino]hexan-2-yl]-5,5-dimethyl-4-oxohexanamide |
| SMILES | CC(C)(C)NCCCCC(NC(=O)CCC(=O)C(C)(C)C)C(=O)NC(CCC(=O)C(C)(C)C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C31H57N3O5/c1-28(2,3)23(35)17-16-21(26(38)30(7,8)9)34-27(39)22(15-13-14-20-32-31(10,11)12)33-25(37)19-18-24(36)29(4,5)6/h21-22,32H,13-20H2,1-12H3,(H,33,37)(H,34,39) |
| InChIKey | UXKCWENNLVIUTF-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.81 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|