C33H70N6O2 — CID 88594378
N-[5-[2,6-bis(tert-butylamino)hexanoylamino]pentyl]-2,6-bis(tert-butylamino)hexanamide (PubChem CID 88594378) has the molecular formula C33H70N6O2 and a molecular weight of 582.96 g/mol. Its IUPAC name is N-[5-[2,6-bis(tert-butylamino)hexanoylamino]pentyl]-2,6-bis(tert-butylamino)hexanamide.
| Compound Name | N-[5-[2,6-bis(tert-butylamino)hexanoylamino]pentyl]-2,6-bis(tert-butylamino)hexanamide |
|---|---|
| PubChem CID | 88594378 |
| Molecular Formula | C33H70N6O2 |
| Molecular Weight | 582.96 g/mol |
| Exact Mass | 582.56 |
| IUPAC Name | N-[5-[2,6-bis(tert-butylamino)hexanoylamino]pentyl]-2,6-bis(tert-butylamino)hexanamide |
| SMILES | CC(C)(C)NCCCCC(NC(C)(C)C)C(=O)NCCCCCNC(=O)C(CCCCNC(C)(C)C)NC(C)(C)C |
| InChI | InChI=1S/C33H70N6O2/c1-30(2,3)36-24-18-14-20-26(38-32(7,8)9)28(40)34-22-16-13-17-23-35-29(41)27(39-33(10,11)12)21-15-19-25-37-31(4,5)6/h26-27,36-39H,13-25H2,1-12H3,(H,34,40)(H,35,41) |
| InChIKey | RFLGDIWOWOUEBF-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 106.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.96 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|