C28H53N3O4 — CID 170406348
2-(tert-butylamino)-N'-(7,7-dimethyl-6-oxooctyl)-N-(7-methyl-6-oxooctyl)pentanediamide (PubChem CID 170406348) has the molecular formula C28H53N3O4 and a molecular weight of 495.75 g/mol. Its IUPAC name is 2-(tert-butylamino)-N'-(7,7-dimethyl-6-oxooctyl)-N-(7-methyl-6-oxooctyl)pentanediamide.
| Compound Name | 2-(tert-butylamino)-N'-(7,7-dimethyl-6-oxooctyl)-N-(7-methyl-6-oxooctyl)pentanediamide |
|---|---|
| PubChem CID | 170406348 |
| Molecular Formula | C28H53N3O4 |
| Molecular Weight | 495.75 g/mol |
| Exact Mass | 495.40 |
| IUPAC Name | 2-(tert-butylamino)-N'-(7,7-dimethyl-6-oxooctyl)-N-(7-methyl-6-oxooctyl)pentanediamide |
| SMILES | CC(C)C(=O)CCCCCNC(=O)C(CCC(=O)NCCCCCC(=O)C(C)(C)C)NC(C)(C)C |
| InChI | InChI=1S/C28H53N3O4/c1-21(2)23(32)15-11-9-14-20-30-26(35)22(31-28(6,7)8)17-18-25(34)29-19-13-10-12-16-24(33)27(3,4)5/h21-22,31H,9-20H2,1-8H3,(H,29,34)(H,30,35) |
| InChIKey | DZHTUJWFLUMBAH-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.75 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|