C25H46N2O4 — CID 170246304
7-methyl-N-[7-[(7-methyl-6-oxooctanoyl)amino]heptyl]-6-oxooctanamide (PubChem CID 170246304) has the molecular formula C25H46N2O4 and a molecular weight of 438.65 g/mol. Its IUPAC name is 7-methyl-N-[7-[(7-methyl-6-oxooctanoyl)amino]heptyl]-6-oxooctanamide.
| Compound Name | 7-methyl-N-[7-[(7-methyl-6-oxooctanoyl)amino]heptyl]-6-oxooctanamide |
|---|---|
| PubChem CID | 170246304 |
| Molecular Formula | C25H46N2O4 |
| Molecular Weight | 438.65 g/mol |
| Exact Mass | 438.35 |
| IUPAC Name | 7-methyl-N-[7-[(7-methyl-6-oxooctanoyl)amino]heptyl]-6-oxooctanamide |
| SMILES | CC(C)C(=O)CCCCC(=O)NCCCCCCCNC(=O)CCCCC(=O)C(C)C |
| InChI | InChI=1S/C25H46N2O4/c1-20(2)22(28)14-8-10-16-24(30)26-18-12-6-5-7-13-19-27-25(31)17-11-9-15-23(29)21(3)4/h20-21H,5-19H2,1-4H3,(H,26,30)(H,27,31) |
| InChIKey | YKRKSGJKXINIHG-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.65 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|